C9H21NO8 — CID 90384650
4-aminononane-1,1,1,2,2,3,3,4-octol (PubChem CID 90384650) has the molecular formula C9H21NO8 and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-aminononane-1,1,1,2,2,3,3,4-octol.
| Compound Name | 4-aminononane-1,1,1,2,2,3,3,4-octol |
|---|---|
| PubChem CID | 90384650 |
| Molecular Formula | C9H21NO8 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-aminononane-1,1,1,2,2,3,3,4-octol |
| SMILES | CCCCCC(N)(O)C(O)(O)C(O)(O)C(O)(O)O |
| InChI | InChI=1S/C9H21NO8/c1-2-3-4-5-6(10,11)7(12,13)8(14,15)9(16,17)18/h11-18H,2-5,10H2,1H3 |
| InChIKey | RELCXNIBBLAHPN-UHFFFAOYSA-N |
| XLogP | -3.79 |
| TPSA | 187.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|