C15H32O3 — CID 19424783
2,2-dibutylheptane-1,1,1-triol (PubChem CID 19424783) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is 2,2-dibutylheptane-1,1,1-triol.
| Compound Name | 2,2-dibutylheptane-1,1,1-triol |
|---|---|
| PubChem CID | 19424783 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | 2,2-dibutylheptane-1,1,1-triol |
| SMILES | CCCCCC(CCCC)(CCCC)C(O)(O)O |
| InChI | InChI=1S/C15H32O3/c1-4-7-10-13-14(11-8-5-2,12-9-6-3)15(16,17)18/h16-18H,4-13H2,1-3H3 |
| InChIKey | IRNQYKGOOQNDIE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|