C19H45NO3 — CID 175455322
azane;5,6-dibutylundecane-5,6-diol;hydrate (PubChem CID 175455322) has the molecular formula C19H45NO3 and a molecular weight of 335.57 g/mol. Its IUPAC name is azane;5,6-dibutylundecane-5,6-diol;hydrate.
| Compound Name | azane;5,6-dibutylundecane-5,6-diol;hydrate |
|---|---|
| PubChem CID | 175455322 |
| Molecular Formula | C19H45NO3 |
| Molecular Weight | 335.57 g/mol |
| Exact Mass | 335.34 |
| IUPAC Name | azane;5,6-dibutylundecane-5,6-diol;hydrate |
| SMILES | CCCCCC(O)(CCCC)C(O)(CCCC)CCCC.N.O |
| InChI | InChI=1S/C19H40O2.H3N.H2O/c1-5-9-13-17-19(21,16-12-8-4)18(20,14-10-6-2)15-11-7-3;;/h20-21H,5-17H2,1-4H3;1H3;1H2 |
| InChIKey | PJEPDHQLVVCVMH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|