C24H51O5Ti — CID 87506022
hydroxy(oxo)titanium;2-octyl-2-(1,1,2-tritritiohexyl)decane-1,1,1-triol (PubChem CID 87506022) has the molecular formula C24H51O5Ti and a molecular weight of 473.56 g/mol. Its IUPAC name is hydroxy(oxo)titanium;2-octyl-2-(1,1,2-tritritiohexyl)decane-1,1,1-triol.
| Compound Name | hydroxy(oxo)titanium;2-octyl-2-(1,1,2-tritritiohexyl)decane-1,1,1-triol |
|---|---|
| PubChem CID | 87506022 |
| Molecular Formula | C24H51O5Ti |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | hydroxy(oxo)titanium;2-octyl-2-(1,1,2-tritritiohexyl)decane-1,1,1-triol |
| SMILES | O=[Ti]O.[3H]C(CCCC)C([3H])([3H])C(CCCCCCCC)(CCCCCCCC)C(O)(O)O |
| InChI | InChI=1S/C24H50O3.H2O.O.Ti/c1-4-7-10-13-15-18-21-23(24(25,26)27,20-17-12-9-6-3)22-19-16-14-11-8-5-2;;;/h25-27H,4-22H2,1-3H3;1H2;;/q;;;+1/p-1/i17T,20T2;;; |
| InChIKey | CENIDWYMDCCADO-BDTBXQAMSA-M |
| XLogP | 6.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|