C22H48O6 — CID 175727571
2,2-dibutylhexane-1,1,1-triol;1,1,1-triethoxyethane (PubChem CID 175727571) has the molecular formula C22H48O6 and a molecular weight of 408.62 g/mol. Its IUPAC name is 2,2-dibutylhexane-1,1,1-triol;1,1,1-triethoxyethane.
| Compound Name | 2,2-dibutylhexane-1,1,1-triol;1,1,1-triethoxyethane |
|---|---|
| PubChem CID | 175727571 |
| Molecular Formula | C22H48O6 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | 2,2-dibutylhexane-1,1,1-triol;1,1,1-triethoxyethane |
| SMILES | CCCCC(CCCC)(CCCC)C(O)(O)O.CCOC(C)(OCC)OCC |
| InChI | InChI=1S/C14H30O3.C8H18O3/c1-4-7-10-13(11-8-5-2,12-9-6-3)14(15,16)17;1-5-9-8(4,10-6-2)11-7-3/h15-17H,4-12H2,1-3H3;5-7H2,1-4H3 |
| InChIKey | MRKJODFRBADKOJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|