C23H26N2O6 — CID 141107685
3-[4-[2-nitro-3-(4-propylpiperidin-1-yl)phenoxy]phenyl]-3-oxopropanoic acid (PubChem CID 141107685) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-[4-[2-nitro-3-(4-propylpiperidin-1-yl)phenoxy]phenyl]-3-oxopropanoic acid.
| Compound Name | 3-[4-[2-nitro-3-(4-propylpiperidin-1-yl)phenoxy]phenyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 141107685 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-[4-[2-nitro-3-(4-propylpiperidin-1-yl)phenoxy]phenyl]-3-oxopropanoic acid |
| SMILES | CCCC1CCN(c2cccc(Oc3ccc(C(=O)CC(=O)O)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H26N2O6/c1-2-4-16-11-13-24(14-12-16)19-5-3-6-21(23(19)25(29)30)31-18-9-7-17(8-10-18)20(26)15-22(27)28/h3,5-10,16H,2,4,11-15H2,1H3,(H,27,28) |
| InChIKey | RGSWZRRPKFJQPD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|