C23H29N3O4 — CID 58216406
4-[4-[[3-nitro-4-(4-propylpiperidin-1-yl)-2-pyridinyl]oxy]phenyl]butan-2-one (PubChem CID 58216406) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-[4-[[3-nitro-4-(4-propylpiperidin-1-yl)-2-pyridinyl]oxy]phenyl]butan-2-one.
| Compound Name | 4-[4-[[3-nitro-4-(4-propylpiperidin-1-yl)-2-pyridinyl]oxy]phenyl]butan-2-one |
|---|---|
| PubChem CID | 58216406 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-[4-[[3-nitro-4-(4-propylpiperidin-1-yl)-2-pyridinyl]oxy]phenyl]butan-2-one |
| SMILES | CCCC1CCN(c2ccnc(Oc3ccc(CCC(C)=O)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H29N3O4/c1-3-4-18-12-15-25(16-13-18)21-11-14-24-23(22(21)26(28)29)30-20-9-7-19(8-10-20)6-5-17(2)27/h7-11,14,18H,3-6,12-13,15-16H2,1-2H3 |
| InChIKey | BJDRSNFRCPTVLC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|