C21H25F2N3O3 — CID 175245185
4-(2,4-difluorophenoxy)-3-nitro-2-[2-(4-propylpiperidin-1-yl)ethyl]pyridine (PubChem CID 175245185) has the molecular formula C21H25F2N3O3 and a molecular weight of 405.45 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-3-nitro-2-[2-(4-propylpiperidin-1-yl)ethyl]pyridine.
| Compound Name | 4-(2,4-difluorophenoxy)-3-nitro-2-[2-(4-propylpiperidin-1-yl)ethyl]pyridine |
|---|---|
| PubChem CID | 175245185 |
| Molecular Formula | C21H25F2N3O3 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-3-nitro-2-[2-(4-propylpiperidin-1-yl)ethyl]pyridine |
| SMILES | CCCC1CCN(CCc2nccc(Oc3ccc(F)cc3F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H25F2N3O3/c1-2-3-15-7-11-25(12-8-15)13-9-18-21(26(27)28)20(6-10-24-18)29-19-5-4-16(22)14-17(19)23/h4-6,10,14-15H,2-3,7-9,11-13H2,1H3 |
| InChIKey | PPHNJVQEXGAVRL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|