C26H28ClNO2 — CID 141107916
N-[(4-tert-butylphenyl)methyl]-N-[(4-chlorophenyl)methyl]-2-phenoxyacetamide (PubChem CID 141107916) has the molecular formula C26H28ClNO2 and a molecular weight of 421.97 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N-[(4-chlorophenyl)methyl]-2-phenoxyacetamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N-[(4-chlorophenyl)methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 141107916 |
| Molecular Formula | C26H28ClNO2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N-[(4-chlorophenyl)methyl]-2-phenoxyacetamide |
| SMILES | CC(C)(C)c1ccc(CN(Cc2ccc(Cl)cc2)C(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28ClNO2/c1-26(2,3)22-13-9-20(10-14-22)17-28(18-21-11-15-23(27)16-12-21)25(29)19-30-24-7-5-4-6-8-24/h4-16H,17-19H2,1-3H3 |
| InChIKey | WXDPRFKUBYLQNW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |