C13H24N2O7S — CID 141108776
(2R)-2-[butoxycarbonyl-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]amino]amino]-3-sulfanylpropanoic acid (PubChem CID 141108776) has the molecular formula C13H24N2O7S and a molecular weight of 352.41 g/mol. Its IUPAC name is (2R)-2-[butoxycarbonyl-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]amino]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[butoxycarbonyl-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]amino]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 141108776 |
| Molecular Formula | C13H24N2O7S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (2R)-2-[butoxycarbonyl-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]amino]amino]-3-sulfanylpropanoic acid |
| SMILES | CCCCOC(=O)N(N[C@H](C(=O)OC)[C@@H](C)O)[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C13H24N2O7S/c1-4-5-6-22-13(20)15(9(7-23)11(17)18)14-10(8(2)16)12(19)21-3/h8-10,14,16,23H,4-7H2,1-3H3,(H,17,18)/t8-,9+,10+/m1/s1 |
| InChIKey | SOZBTPLCCZLNOK-UTLUCORTSA-N |
| XLogP | 0.04 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|