C14H9NO4S — CID 141109654
5-phenyl-6H-thieno[2,3-b]pyrrole-2,4-dicarboxylic acid (PubChem CID 141109654) has the molecular formula C14H9NO4S and a molecular weight of 287.30 g/mol. Its IUPAC name is 5-phenyl-6H-thieno[2,3-b]pyrrole-2,4-dicarboxylic acid.
| Compound Name | 5-phenyl-6H-thieno[2,3-b]pyrrole-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 141109654 |
| Molecular Formula | C14H9NO4S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 5-phenyl-6H-thieno[2,3-b]pyrrole-2,4-dicarboxylic acid |
| SMILES | O=C(O)c1cc2c(C(=O)O)c(-c3ccccc3)[nH]c2s1 |
| InChI | InChI=1S/C14H9NO4S/c16-13(17)9-6-8-10(14(18)19)11(15-12(8)20-9)7-4-2-1-3-5-7/h1-6,15H,(H,16,17)(H,18,19) |
| InChIKey | FHODEAKPFRVVJC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |