C8H11FN2 — CID 141109695
N-[(4-fluoro-1H-pyrrol-3-yl)methyl]cyclopropanamine (PubChem CID 141109695) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is N-[(4-fluoro-1H-pyrrol-3-yl)methyl]cyclopropanamine.
| Compound Name | N-[(4-fluoro-1H-pyrrol-3-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 141109695 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | N-[(4-fluoro-1H-pyrrol-3-yl)methyl]cyclopropanamine |
| SMILES | Fc1c[nH]cc1CNC1CC1 |
| InChI | InChI=1S/C8H11FN2/c9-8-5-10-3-6(8)4-11-7-1-2-7/h3,5,7,10-11H,1-2,4H2 |
| InChIKey | JNDQKDAQHIABNS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |