C10H15BrN4O — CID 141111981
2-[(3R)-3-aminopiperidin-1-yl]-5-bromo-4-methyl-1H-pyrimidin-6-one (PubChem CID 141111981) has the molecular formula C10H15BrN4O and a molecular weight of 287.16 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-5-bromo-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-bromo-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 141111981 |
| Molecular Formula | C10H15BrN4O |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-bromo-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N2CCC[C@@H](N)C2)[nH]c(=O)c1Br |
| InChI | InChI=1S/C10H15BrN4O/c1-6-8(11)9(16)14-10(13-6)15-4-2-3-7(12)5-15/h7H,2-5,12H2,1H3,(H,13,14,16)/t7-/m1/s1 |
| InChIKey | MTZDFKDVLJWKEA-SSDOTTSWSA-N |
| XLogP | 0.77 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |