C13H21BrN4O — CID 141111979
2-(3-aminopiperidin-1-yl)-5-bromo-4-tert-butyl-1H-pyrimidin-6-one (PubChem CID 141111979) has the molecular formula C13H21BrN4O and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-5-bromo-4-tert-butyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3-aminopiperidin-1-yl)-5-bromo-4-tert-butyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 141111979 |
| Molecular Formula | C13H21BrN4O |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-5-bromo-4-tert-butyl-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)c1nc(N2CCCC(N)C2)[nH]c(=O)c1Br |
| InChI | InChI=1S/C13H21BrN4O/c1-13(2,3)10-9(14)11(19)17-12(16-10)18-6-4-5-8(15)7-18/h8H,4-7,15H2,1-3H3,(H,16,17,19) |
| InChIKey | MGLCJSGQZKPDIX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |