About tetraisocyanatostannane
tetraisocyanatostannane (PubChem CID 141113751) has the molecular formula C4N4O4Sn
and a molecular weight of 286.78 g/mol. Its IUPAC name is tetraisocyanatostannane.
Molecular Properties
| Compound Name | tetraisocyanatostannane |
| PubChem CID | 141113751 |
| Molecular Formula | C4N4O4Sn |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 287.89 |
| IUPAC Name | tetraisocyanatostannane |
| SMILES | O=C=N[Sn](N=C=O)(N=C=O)N=C=O |
| InChI | InChI=1S/4CNO.Sn/c4*2-1-3;/q4*-1;+4 |
| InChIKey | DMAZIRSKQBAGAH-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze tetraisocyanatostannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraisocyanatostannane?
The IUPAC name of tetraisocyanatostannane (CID 141113751) is tetraisocyanatostannane.
What is the SMILES notation for tetraisocyanatostannane?
The canonical SMILES for tetraisocyanatostannane is O=C=N[Sn](N=C=O)(N=C=O)N=C=O.
What is the InChIKey of tetraisocyanatostannane?
The InChIKey is DMAZIRSKQBAGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/4CNO.Sn/c4*2-1-3;/q4*-1;+4.
What are the key properties of tetraisocyanatostannane?
tetraisocyanatostannane has a molecular weight of 286.78 g/mol, XLogP of -1.23, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tetraisocyanatostannane is sourced from PubChem (CID 141113751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).