About bismuthane;isocyanatobismuthane
bismuthane;isocyanatobismuthane (PubChem CID 173301787) has the molecular formula CH8Bi3NO
and a molecular weight of 677.02 g/mol. Its IUPAC name is bismuthane;isocyanatobismuthane.
Molecular Properties
| Compound Name | bismuthane;isocyanatobismuthane |
| PubChem CID | 173301787 |
| Molecular Formula | CH8Bi3NO |
| Molecular Weight | 677.02 g/mol |
| Exact Mass | 677.00 |
| IUPAC Name | bismuthane;isocyanatobismuthane |
| SMILES | O=C=N[BiH2].[BiH3].[BiH3] |
| InChI | InChI=1S/CNO.3Bi.8H/c2-1-3;;;;;;;;;;;/q-1;;;+1;;;;;;;; |
| InChIKey | MHHQZPSVHOQSSR-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 677.02 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze bismuthane;isocyanatobismuthane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;isocyanatobismuthane?
The IUPAC name of bismuthane;isocyanatobismuthane (CID 173301787) is bismuthane;isocyanatobismuthane.
What is the SMILES notation for bismuthane;isocyanatobismuthane?
The canonical SMILES for bismuthane;isocyanatobismuthane is O=C=N[BiH2].[BiH3].[BiH3].
What is the InChIKey of bismuthane;isocyanatobismuthane?
The InChIKey is MHHQZPSVHOQSSR-UHFFFAOYSA-N. The full InChI is InChI=1S/CNO.3Bi.8H/c2-1-3;;;;;;;;;;;/q-1;;;+1;;;;;;;;.
What are the key properties of bismuthane;isocyanatobismuthane?
bismuthane;isocyanatobismuthane has a molecular weight of 677.02 g/mol, XLogP of -3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;isocyanatobismuthane is sourced from PubChem (CID 173301787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).