C21H14N2OS — CID 141116001
2-[2-(1-benzofuran-2-yl)-6-(1H-pyrrol-2-yl)phenyl]-1,3-thiazole (PubChem CID 141116001) has the molecular formula C21H14N2OS and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[2-(1-benzofuran-2-yl)-6-(1H-pyrrol-2-yl)phenyl]-1,3-thiazole.
| Compound Name | 2-[2-(1-benzofuran-2-yl)-6-(1H-pyrrol-2-yl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 141116001 |
| Molecular Formula | C21H14N2OS |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[2-(1-benzofuran-2-yl)-6-(1H-pyrrol-2-yl)phenyl]-1,3-thiazole |
| SMILES | c1c[nH]c(-c2cccc(-c3cc4ccccc4o3)c2-c2nccs2)c1 |
| InChI | InChI=1S/C21H14N2OS/c1-2-9-18-14(5-1)13-19(24-18)16-7-3-6-15(17-8-4-10-22-17)20(16)21-23-11-12-25-21/h1-13,22H |
| InChIKey | MNIYNZMLXQUJHH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |