C11H23NO3 — CID 141116267
(4-hydroxy-2-methylpentan-2-yl) N-tert-butylcarbamate (PubChem CID 141116267) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is (4-hydroxy-2-methylpentan-2-yl) N-tert-butylcarbamate.
| Compound Name | (4-hydroxy-2-methylpentan-2-yl) N-tert-butylcarbamate |
|---|---|
| PubChem CID | 141116267 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | (4-hydroxy-2-methylpentan-2-yl) N-tert-butylcarbamate |
| SMILES | CC(O)CC(C)(C)OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H23NO3/c1-8(13)7-11(5,6)15-9(14)12-10(2,3)4/h8,13H,7H2,1-6H3,(H,12,14) |
| InChIKey | SKHRVSCZVDZAKH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |