C8H17N5O3 — CID 141117590
tert-butyl N-[(2Z)-2-amino-2-[(E)-N'-hydroxycarbamimidoyl]iminoethyl]carbamate (PubChem CID 141117590) has the molecular formula C8H17N5O3 and a molecular weight of 231.26 g/mol. Its IUPAC name is tert-butyl N-[(2Z)-2-amino-2-[(E)-N'-hydroxycarbamimidoyl]iminoethyl]carbamate.
| Compound Name | tert-butyl N-[(2Z)-2-amino-2-[(E)-N'-hydroxycarbamimidoyl]iminoethyl]carbamate |
|---|---|
| PubChem CID | 141117590 |
| Molecular Formula | C8H17N5O3 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl N-[(2Z)-2-amino-2-[(E)-N'-hydroxycarbamimidoyl]iminoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C(N)=N/C(N)=N/O |
| InChI | InChI=1S/C8H17N5O3/c1-8(2,3)16-7(14)11-4-5(9)12-6(10)13-15/h15H,4H2,1-3H3,(H,11,14)(H4,9,10,12,13) |
| InChIKey | WZTABHSCRCMCDF-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|