C11H21N5O4 — CID 533649
tert-butyl N-[2-[[2-amino-2-(2-amino-2-oxoethyl)iminoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 533649) has the molecular formula C11H21N5O4 and a molecular weight of 287.32 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-amino-2-(2-amino-2-oxoethyl)iminoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-amino-2-(2-amino-2-oxoethyl)iminoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 533649 |
| Molecular Formula | C11H21N5O4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | tert-butyl N-[2-[[2-amino-2-(2-amino-2-oxoethyl)iminoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC/C(N)=N/CC(N)=O |
| InChI | InChI=1S/C11H21N5O4/c1-11(2,3)20-10(19)16-6-9(18)15-4-7(12)14-5-8(13)17/h4-6H2,1-3H3,(H2,12,14)(H2,13,17)(H,15,18)(H,16,19) |
| InChIKey | FVKBKBMAKAEOKA-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|