C9H18N4O3 — CID 567732
tert-butyl N-[2-[(2-amino-2-iminoethyl)amino]-2-oxoethyl]carbamate (PubChem CID 567732) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-amino-2-iminoethyl)amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-amino-2-iminoethyl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 567732 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | tert-butyl N-[2-[(2-amino-2-iminoethyl)amino]-2-oxoethyl]carbamate |
| SMILES | [H]/N=C(\N)CNC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18N4O3/c1-9(2,3)16-8(15)13-5-7(14)12-4-6(10)11/h4-5H2,1-3H3,(H3,10,11)(H,12,14)(H,13,15) |
| InChIKey | SOGXPXBEVYRNLW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|