2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid

C8H12Cl2NO3P — CID 141117796

IUPAC2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid
SMILESO=P#CCCCCCC(C(=O)O)N(Cl)Cl
InChIInChI=1S/C8H12Cl2NO3P/c9-11(10)7(8(12)13)5-3-1-2-4-6-15-14/h7H,1-5H2,(H,12,13)
InChIKeyJTPOIWDQLLGKNY-UHFFFAOYSA-N
MW272.07 g/mol
LogP3.25
Rot. Bonds7

About 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid

2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid (PubChem CID 141117796) has the molecular formula C8H12Cl2NO3P and a molecular weight of 272.07 g/mol. Its IUPAC name is 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid.

Molecular Properties

Compound Name2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid
PubChem CID141117796
Molecular FormulaC8H12Cl2NO3P
Molecular Weight272.07 g/mol
Exact Mass270.99
IUPAC Name2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid
SMILESO=P#CCCCCCC(C(=O)O)N(Cl)Cl
InChIInChI=1S/C8H12Cl2NO3P/c9-11(10)7(8(12)13)5-3-1-2-4-6-15-14/h7H,1-5H2,(H,12,13)
InChIKeyJTPOIWDQLLGKNY-UHFFFAOYSA-N
XLogP3.25
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.07
LogP ≤ 53.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid?
The IUPAC name of 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid (CID 141117796) is 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid.
What is the SMILES notation for 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid?
The canonical SMILES for 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid is O=P#CCCCCCC(C(=O)O)N(Cl)Cl.
What is the InChIKey of 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid?
The InChIKey is JTPOIWDQLLGKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12Cl2NO3P/c9-11(10)7(8(12)13)5-3-1-2-4-6-15-14/h7H,1-5H2,(H,12,13).
What are the key properties of 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid?
2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid has a molecular weight of 272.07 g/mol, XLogP of 3.25, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloroamino)-8-(oxo-λ5-phosphanylidyne)octanoic acid is sourced from PubChem (CID 141117796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).