C11H12F3N3O3S — CID 141117890
3-oxo-4-[4-(trifluoromethyl)phenyl]piperazine-1-sulfonamide (PubChem CID 141117890) has the molecular formula C11H12F3N3O3S and a molecular weight of 323.30 g/mol. Its IUPAC name is 3-oxo-4-[4-(trifluoromethyl)phenyl]piperazine-1-sulfonamide.
| Compound Name | 3-oxo-4-[4-(trifluoromethyl)phenyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 141117890 |
| Molecular Formula | C11H12F3N3O3S |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-oxo-4-[4-(trifluoromethyl)phenyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(c2ccc(C(F)(F)F)cc2)C(=O)C1 |
| InChI | InChI=1S/C11H12F3N3O3S/c12-11(13,14)8-1-3-9(4-2-8)17-6-5-16(7-10(17)18)21(15,19)20/h1-4H,5-7H2,(H2,15,19,20) |
| InChIKey | YSPYLTODRNUXNF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |