C4H2Br4O6 — CID 141118233
2,2-dibromo-2-[dibromo(carboxy)methyl]peroxyacetic acid (PubChem CID 141118233) has the molecular formula C4H2Br4O6 and a molecular weight of 465.67 g/mol. Its IUPAC name is 2,2-dibromo-2-[dibromo(carboxy)methyl]peroxyacetic acid.
| Compound Name | 2,2-dibromo-2-[dibromo(carboxy)methyl]peroxyacetic acid |
|---|---|
| PubChem CID | 141118233 |
| Molecular Formula | C4H2Br4O6 |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 461.66 |
| IUPAC Name | 2,2-dibromo-2-[dibromo(carboxy)methyl]peroxyacetic acid |
| SMILES | O=C(O)C(Br)(Br)OOC(Br)(Br)C(=O)O |
| InChI | InChI=1S/C4H2Br4O6/c5-3(6,1(9)10)13-14-4(7,8)2(11)12/h(H,9,10)(H,11,12) |
| InChIKey | BKHZSZHHCHSEAI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|