C19H13ClF3N3OS — CID 141118320
N-[1-(2-chloro-4-cyanophenoxy)-2-cyanopropan-2-yl]-4-(trifluoromethyl)benzenecarbothioamide (PubChem CID 141118320) has the molecular formula C19H13ClF3N3OS and a molecular weight of 423.85 g/mol. Its IUPAC name is N-[1-(2-chloro-4-cyanophenoxy)-2-cyanopropan-2-yl]-4-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | N-[1-(2-chloro-4-cyanophenoxy)-2-cyanopropan-2-yl]-4-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 141118320 |
| Molecular Formula | C19H13ClF3N3OS |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | N-[1-(2-chloro-4-cyanophenoxy)-2-cyanopropan-2-yl]-4-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CC(C#N)(COc1ccc(C#N)cc1Cl)NC(=S)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H13ClF3N3OS/c1-18(10-25,11-27-16-7-2-12(9-24)8-15(16)20)26-17(28)13-3-5-14(6-4-13)19(21,22)23/h2-8H,11H2,1H3,(H,26,28) |
| InChIKey | UVMGHTSMIBAAAS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|