C19H8ClF5N4OS — CID 87488048
N-[(2R)-1-(2-chloro-4,5-dicyanophenoxy)-2-cyanopropan-2-yl]-2,3,4,5,6-pentafluorobenzenecarbothioamide (PubChem CID 87488048) has the molecular formula C19H8ClF5N4OS and a molecular weight of 470.81 g/mol. Its IUPAC name is N-[(2R)-1-(2-chloro-4,5-dicyanophenoxy)-2-cyanopropan-2-yl]-2,3,4,5,6-pentafluorobenzenecarbothioamide.
| Compound Name | N-[(2R)-1-(2-chloro-4,5-dicyanophenoxy)-2-cyanopropan-2-yl]-2,3,4,5,6-pentafluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 87488048 |
| Molecular Formula | C19H8ClF5N4OS |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | N-[(2R)-1-(2-chloro-4,5-dicyanophenoxy)-2-cyanopropan-2-yl]-2,3,4,5,6-pentafluorobenzenecarbothioamide |
| SMILES | C[C@@](C#N)(COc1cc(C#N)c(C#N)cc1Cl)NC(=S)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H8ClF5N4OS/c1-19(6-28,7-30-11-3-9(5-27)8(4-26)2-10(11)20)29-18(31)12-13(21)15(23)17(25)16(24)14(12)22/h2-3H,7H2,1H3,(H,29,31)/t19-/m1/s1 |
| InChIKey | FZSQOAFCWVZXII-LJQANCHMSA-N |
| XLogP | 4.41 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|