C28H35N3O4 — CID 141118832
6-[bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]amino]hexanoic acid (PubChem CID 141118832) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is 6-[bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]amino]hexanoic acid.
| Compound Name | 6-[bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 141118832 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 6-[bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCN(CC(=O)N1CCc2ccccc2C1)CC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C28H35N3O4/c32-26(30-16-13-22-8-3-5-10-24(22)18-30)20-29(15-7-1-2-12-28(34)35)21-27(33)31-17-14-23-9-4-6-11-25(23)19-31/h3-6,8-11H,1-2,7,12-21H2,(H,34,35) |
| InChIKey | XIPNBELRYYMXCS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|