C16H20N2O3 — CID 79269740
2-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-prop-2-enylamino]acetic acid (PubChem CID 79269740) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-prop-2-enylamino]acetic acid.
| Compound Name | 2-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79269740 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)CC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H20N2O3/c1-2-8-17(12-16(20)21)11-15(19)18-9-7-13-5-3-4-6-14(13)10-18/h2-6H,1,7-12H2,(H,20,21) |
| InChIKey | BZYCFSGFDVIYNL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|