C8H12N4 — CID 141119214
3-(1H-1,2,4-triazol-5-ylmethylidene)piperidine (PubChem CID 141119214) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-ylmethylidene)piperidine.
| Compound Name | 3-(1H-1,2,4-triazol-5-ylmethylidene)piperidine |
|---|---|
| PubChem CID | 141119214 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-ylmethylidene)piperidine |
| SMILES | C(=C1CCCNC1)c1ncn[nH]1 |
| InChI | InChI=1S/C8H12N4/c1-2-7(5-9-3-1)4-8-10-6-11-12-8/h4,6,9H,1-3,5H2,(H,10,11,12) |
| InChIKey | IONZAYZEJOVGRV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |