C14H21N3O2 — CID 141119346
ethyl 3-[3-(piperidin-3-ylidenemethyl)pyrazol-1-yl]propanoate (PubChem CID 141119346) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is ethyl 3-[3-(piperidin-3-ylidenemethyl)pyrazol-1-yl]propanoate.
| Compound Name | ethyl 3-[3-(piperidin-3-ylidenemethyl)pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 141119346 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | ethyl 3-[3-(piperidin-3-ylidenemethyl)pyrazol-1-yl]propanoate |
| SMILES | CCOC(=O)CCn1ccc(C=C2CCCNC2)n1 |
| InChI | InChI=1S/C14H21N3O2/c1-2-19-14(18)6-9-17-8-5-13(16-17)10-12-4-3-7-15-11-12/h5,8,10,15H,2-4,6-7,9,11H2,1H3 |
| InChIKey | DZROCPQLJMYRIC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |