C16H23N3O3S — CID 87565785
ethyl 3-[3-[(E)-[(4R)-4-acetylsulfanylpiperidin-3-ylidene]methyl]pyrazol-1-yl]propanoate (PubChem CID 87565785) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is ethyl 3-[3-[(E)-[(4R)-4-acetylsulfanylpiperidin-3-ylidene]methyl]pyrazol-1-yl]propanoate.
| Compound Name | ethyl 3-[3-[(E)-[(4R)-4-acetylsulfanylpiperidin-3-ylidene]methyl]pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 87565785 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | ethyl 3-[3-[(E)-[(4R)-4-acetylsulfanylpiperidin-3-ylidene]methyl]pyrazol-1-yl]propanoate |
| SMILES | CCOC(=O)CCn1ccc(/C=C2\CNCC[C@H]2SC(C)=O)n1 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-22-16(21)6-9-19-8-5-14(18-19)10-13-11-17-7-4-15(13)23-12(2)20/h5,8,10,15,17H,3-4,6-7,9,11H2,1-2H3/b13-10+/t15-/m1/s1 |
| InChIKey | IMHLIKJAHTVMDF-NRMKIYEFSA-N |
| XLogP | 1.86 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|