C14H18F3N3O3S — CID 87566911
S-[(3E)-3-[(1-methylpyrazol-3-yl)methylidene]piperidin-4-yl] ethanethioate;2,2,2-trifluoroacetic acid (PubChem CID 87566911) has the molecular formula C14H18F3N3O3S and a molecular weight of 365.38 g/mol. Its IUPAC name is S-[(3E)-3-[(1-methylpyrazol-3-yl)methylidene]piperidin-4-yl] ethanethioate;2,2,2-trifluoroacetic acid.
| Compound Name | S-[(3E)-3-[(1-methylpyrazol-3-yl)methylidene]piperidin-4-yl] ethanethioate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87566911 |
| Molecular Formula | C14H18F3N3O3S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | S-[(3E)-3-[(1-methylpyrazol-3-yl)methylidene]piperidin-4-yl] ethanethioate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)SC1CCNC/C1=C\c1ccn(C)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17N3OS.C2HF3O2/c1-9(16)17-12-3-5-13-8-10(12)7-11-4-6-15(2)14-11;3-2(4,5)1(6)7/h4,6-7,12-13H,3,5,8H2,1-2H3;(H,6,7)/b10-7+; |
| InChIKey | AUCYLBSUDDBSGV-HCUGZAAXSA-N |
| XLogP | 2.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|