C13H15F3N2O4S — CID 87566923
S-[(3E)-3-(1,3-oxazol-4-ylmethylidene)piperidin-4-yl] ethanethioate;2,2,2-trifluoroacetic acid (PubChem CID 87566923) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is S-[(3E)-3-(1,3-oxazol-4-ylmethylidene)piperidin-4-yl] ethanethioate;2,2,2-trifluoroacetic acid.
| Compound Name | S-[(3E)-3-(1,3-oxazol-4-ylmethylidene)piperidin-4-yl] ethanethioate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87566923 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | S-[(3E)-3-(1,3-oxazol-4-ylmethylidene)piperidin-4-yl] ethanethioate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)SC1CCNC/C1=C\c1cocn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H14N2O2S.C2HF3O2/c1-8(14)16-11-2-3-12-5-9(11)4-10-6-15-7-13-10;3-2(4,5)1(6)7/h4,6-7,11-12H,2-3,5H2,1H3;(H,6,7)/b9-4+; |
| InChIKey | BMKBVIXVPYZYJZ-JOKMOOFLSA-N |
| XLogP | 2.33 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|