C19H27F3N4O5S — CID 23138653
ethyl 5-[5-[(E)-(4-acetylsulfanylpiperidin-3-ylidene)methyl]triazol-1-yl]pentanoate;2,2,2-trifluoroacetic acid (PubChem CID 23138653) has the molecular formula C19H27F3N4O5S and a molecular weight of 480.51 g/mol. Its IUPAC name is ethyl 5-[5-[(E)-(4-acetylsulfanylpiperidin-3-ylidene)methyl]triazol-1-yl]pentanoate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 5-[5-[(E)-(4-acetylsulfanylpiperidin-3-ylidene)methyl]triazol-1-yl]pentanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23138653 |
| Molecular Formula | C19H27F3N4O5S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | ethyl 5-[5-[(E)-(4-acetylsulfanylpiperidin-3-ylidene)methyl]triazol-1-yl]pentanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)CCCCn1nncc1/C=C1\CNCCC1SC(C)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O3S.C2HF3O2/c1-3-24-17(23)6-4-5-9-21-15(12-19-20-21)10-14-11-18-8-7-16(14)25-13(2)22;3-2(4,5)1(6)7/h10,12,16,18H,3-9,11H2,1-2H3;(H,6,7)/b14-10+; |
| InChIKey | QUAHSYNYAIEYMY-KMZJGFRYSA-N |
| XLogP | 2.67 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|