C15H23N5O3S — CID 150220157
ethyl 4-[5-[(E)-(4-acetylsulfanylpiperidin-3-ylidene)methyl]tetrazol-1-yl]butanoate (PubChem CID 150220157) has the molecular formula C15H23N5O3S and a molecular weight of 353.45 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-(4-acetylsulfanylpiperidin-3-ylidene)methyl]tetrazol-1-yl]butanoate.
| Compound Name | ethyl 4-[5-[(E)-(4-acetylsulfanylpiperidin-3-ylidene)methyl]tetrazol-1-yl]butanoate |
|---|---|
| PubChem CID | 150220157 |
| Molecular Formula | C15H23N5O3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | ethyl 4-[5-[(E)-(4-acetylsulfanylpiperidin-3-ylidene)methyl]tetrazol-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1nnnc1/C=C1\CNCCC1SC(C)=O |
| InChI | InChI=1S/C15H23N5O3S/c1-3-23-15(22)5-4-8-20-14(17-18-19-20)9-12-10-16-7-6-13(12)24-11(2)21/h9,13,16H,3-8,10H2,1-2H3/b12-9+ |
| InChIKey | FTHTYWYFMMWTSM-FMIVXFBMSA-N |
| XLogP | 1.04 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|