C12H17N3OS — CID 173109103
S-[3-[(1-methylpyrazol-3-yl)methylidene]piperidin-4-yl] ethanethioate (PubChem CID 173109103) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is S-[3-[(1-methylpyrazol-3-yl)methylidene]piperidin-4-yl] ethanethioate.
| Compound Name | S-[3-[(1-methylpyrazol-3-yl)methylidene]piperidin-4-yl] ethanethioate |
|---|---|
| PubChem CID | 173109103 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | S-[3-[(1-methylpyrazol-3-yl)methylidene]piperidin-4-yl] ethanethioate |
| SMILES | CC(=O)SC1CCNCC1=Cc1ccn(C)n1 |
| InChI | InChI=1S/C12H17N3OS/c1-9(16)17-12-3-5-13-8-10(12)7-11-4-6-15(2)14-11/h4,6-7,12-13H,3,5,8H2,1-2H3 |
| InChIKey | SDDANDYPICFZKH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|