C19H31N3O4S — CID 87661572
ethyl 4-[4-[(2E)-2-(4-acetylsulfanylpiperidin-3-ylidene)ethyl]-3-oxopiperazin-1-yl]butanoate (PubChem CID 87661572) has the molecular formula C19H31N3O4S and a molecular weight of 397.54 g/mol. Its IUPAC name is ethyl 4-[4-[(2E)-2-(4-acetylsulfanylpiperidin-3-ylidene)ethyl]-3-oxopiperazin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-[(2E)-2-(4-acetylsulfanylpiperidin-3-ylidene)ethyl]-3-oxopiperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 87661572 |
| Molecular Formula | C19H31N3O4S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | ethyl 4-[4-[(2E)-2-(4-acetylsulfanylpiperidin-3-ylidene)ethyl]-3-oxopiperazin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCN(C/C=C2\CNCCC2SC(C)=O)C(=O)C1 |
| InChI | InChI=1S/C19H31N3O4S/c1-3-26-19(25)5-4-9-21-11-12-22(18(24)14-21)10-7-16-13-20-8-6-17(16)27-15(2)23/h7,17,20H,3-6,8-14H2,1-2H3/b16-7+ |
| InChIKey | FEXWOTGVYPSIOH-FRKPEAEDSA-N |
| XLogP | 1.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|