C13H24N2O4S — CID 141119885
2-(ethoxymethyl)-1-[2-methyl-2-(2-methylsulfonylethoxy)propyl]imidazole (PubChem CID 141119885) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1-[2-methyl-2-(2-methylsulfonylethoxy)propyl]imidazole.
| Compound Name | 2-(ethoxymethyl)-1-[2-methyl-2-(2-methylsulfonylethoxy)propyl]imidazole |
|---|---|
| PubChem CID | 141119885 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-(ethoxymethyl)-1-[2-methyl-2-(2-methylsulfonylethoxy)propyl]imidazole |
| SMILES | CCOCc1nccn1CC(C)(C)OCCS(C)(=O)=O |
| InChI | InChI=1S/C13H24N2O4S/c1-5-18-10-12-14-6-7-15(12)11-13(2,3)19-8-9-20(4,16)17/h6-7H,5,8-11H2,1-4H3 |
| InChIKey | NAJPHLBUHHLBFI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |