C10H16N2O4S — CID 175435591
2-[(1-ethylimidazol-2-yl)methoxy]but-3-ene-2-sulfonic acid (PubChem CID 175435591) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 2-[(1-ethylimidazol-2-yl)methoxy]but-3-ene-2-sulfonic acid.
| Compound Name | 2-[(1-ethylimidazol-2-yl)methoxy]but-3-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 175435591 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[(1-ethylimidazol-2-yl)methoxy]but-3-ene-2-sulfonic acid |
| SMILES | C=CC(C)(OCc1nccn1CC)S(=O)(=O)O |
| InChI | InChI=1S/C10H16N2O4S/c1-4-10(3,17(13,14)15)16-8-9-11-6-7-12(9)5-2/h4,6-7H,1,5,8H2,2-3H3,(H,13,14,15) |
| InChIKey | ZDXZZANSXSXQCP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|