C18H21N3O5S — CID 141121810
2-[4,5-diamino-2-(4-methylsulfonylphenoxy)phenyl]pyrrolidine-1-carboxylic acid (PubChem CID 141121810) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[4,5-diamino-2-(4-methylsulfonylphenoxy)phenyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[4,5-diamino-2-(4-methylsulfonylphenoxy)phenyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141121810 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[4,5-diamino-2-(4-methylsulfonylphenoxy)phenyl]pyrrolidine-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc(N)c(N)cc2C2CCCN2C(=O)O)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-27(24,25)12-6-4-11(5-7-12)26-17-10-15(20)14(19)9-13(17)16-3-2-8-21(16)18(22)23/h4-7,9-10,16H,2-3,8,19-20H2,1H3,(H,22,23) |
| InChIKey | KKARCEWLKFTQMM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|