C27H30FN3O3 — CID 23145792
tert-butyl 2-[4,5-diamino-2-[4-(2-fluorophenyl)phenoxy]phenyl]pyrrolidine-1-carboxylate (PubChem CID 23145792) has the molecular formula C27H30FN3O3 and a molecular weight of 463.55 g/mol. Its IUPAC name is tert-butyl 2-[4,5-diamino-2-[4-(2-fluorophenyl)phenoxy]phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4,5-diamino-2-[4-(2-fluorophenyl)phenoxy]phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23145792 |
| Molecular Formula | C27H30FN3O3 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | tert-butyl 2-[4,5-diamino-2-[4-(2-fluorophenyl)phenoxy]phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1cc(N)c(N)cc1Oc1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/C27H30FN3O3/c1-27(2,3)34-26(32)31-14-6-9-24(31)20-15-22(29)23(30)16-25(20)33-18-12-10-17(11-13-18)19-7-4-5-8-21(19)28/h4-5,7-8,10-13,15-16,24H,6,9,14,29-30H2,1-3H3 |
| InChIKey | WURSUCISYRLOPE-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|