C26H30FN3O — CID 90696104
4-(1-tert-butylpyrrolidin-2-yl)-5-[4-(2-fluorophenyl)phenoxy]benzene-1,2-diamine (PubChem CID 90696104) has the molecular formula C26H30FN3O and a molecular weight of 419.54 g/mol. Its IUPAC name is 4-(1-tert-butylpyrrolidin-2-yl)-5-[4-(2-fluorophenyl)phenoxy]benzene-1,2-diamine.
| Compound Name | 4-(1-tert-butylpyrrolidin-2-yl)-5-[4-(2-fluorophenyl)phenoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 90696104 |
| Molecular Formula | C26H30FN3O |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 4-(1-tert-butylpyrrolidin-2-yl)-5-[4-(2-fluorophenyl)phenoxy]benzene-1,2-diamine |
| SMILES | CC(C)(C)N1CCCC1c1cc(N)c(N)cc1Oc1ccc(-c2ccccc2F)cc1 |
| InChI | InChI=1S/C26H30FN3O/c1-26(2,3)30-14-6-9-24(30)20-15-22(28)23(29)16-25(20)31-18-12-10-17(11-13-18)19-7-4-5-8-21(19)27/h4-5,7-8,10-13,15-16,24H,6,9,14,28-29H2,1-3H3 |
| InChIKey | ZDKDLVQFOQSFPW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|