C12H20O4 — CID 14112420
4-butyl-2,3-diethoxy-4-hydroxycyclobut-2-en-1-one (PubChem CID 14112420) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-butyl-2,3-diethoxy-4-hydroxycyclobut-2-en-1-one.
| Compound Name | 4-butyl-2,3-diethoxy-4-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 14112420 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-butyl-2,3-diethoxy-4-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCC1(O)C(=O)C(OCC)=C1OCC |
| InChI | InChI=1S/C12H20O4/c1-4-7-8-12(14)10(13)9(15-5-2)11(12)16-6-3/h14H,4-8H2,1-3H3 |
| InChIKey | BRXALYIGNUSUFT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |