C10H16O4 — CID 15686146
4-butyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one (PubChem CID 15686146) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 4-butyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one.
| Compound Name | 4-butyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 15686146 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-butyl-4-hydroxy-2,3-dimethoxycyclobut-2-en-1-one |
| SMILES | CCCCC1(O)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C10H16O4/c1-4-5-6-10(12)8(11)7(13-2)9(10)14-3/h12H,4-6H2,1-3H3 |
| InChIKey | DDIHPXFYKNDUKI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |