C12H7ClF2N2O2 — CID 141125071
5-chloro-2-(2,6-difluorophenoxy)pyridine-3-carboxamide (PubChem CID 141125071) has the molecular formula C12H7ClF2N2O2 and a molecular weight of 284.65 g/mol. Its IUPAC name is 5-chloro-2-(2,6-difluorophenoxy)pyridine-3-carboxamide.
| Compound Name | 5-chloro-2-(2,6-difluorophenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141125071 |
| Molecular Formula | C12H7ClF2N2O2 |
| Molecular Weight | 284.65 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 5-chloro-2-(2,6-difluorophenoxy)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc(Cl)cnc1Oc1c(F)cccc1F |
| InChI | InChI=1S/C12H7ClF2N2O2/c13-6-4-7(11(16)18)12(17-5-6)19-10-8(14)2-1-3-9(10)15/h1-5H,(H2,16,18) |
| InChIKey | BUGDAMCLWDLTHI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |