C11H6ClF2NO — CID 141409360
3-chloro-5-(2,6-difluorophenoxy)pyridine (PubChem CID 141409360) has the molecular formula C11H6ClF2NO and a molecular weight of 241.62 g/mol. Its IUPAC name is 3-chloro-5-(2,6-difluorophenoxy)pyridine.
| Compound Name | 3-chloro-5-(2,6-difluorophenoxy)pyridine |
|---|---|
| PubChem CID | 141409360 |
| Molecular Formula | C11H6ClF2NO |
| Molecular Weight | 241.62 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 3-chloro-5-(2,6-difluorophenoxy)pyridine |
| SMILES | Fc1cccc(F)c1Oc1cncc(Cl)c1 |
| InChI | InChI=1S/C11H6ClF2NO/c12-7-4-8(6-15-5-7)16-11-9(13)2-1-3-10(11)14/h1-6H |
| InChIKey | URVQTJFCIPDRQU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |