C15H9Cl2N3O2 — CID 102468102
3,5-bis[(5-chloro-3-pyridinyl)oxy]pyridine (PubChem CID 102468102) has the molecular formula C15H9Cl2N3O2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 3,5-bis[(5-chloro-3-pyridinyl)oxy]pyridine.
| Compound Name | 3,5-bis[(5-chloro-3-pyridinyl)oxy]pyridine |
|---|---|
| PubChem CID | 102468102 |
| Molecular Formula | C15H9Cl2N3O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 3,5-bis[(5-chloro-3-pyridinyl)oxy]pyridine |
| SMILES | Clc1cncc(Oc2cncc(Oc3cncc(Cl)c3)c2)c1 |
| InChI | InChI=1S/C15H9Cl2N3O2/c16-10-1-12(6-18-4-10)21-14-3-15(9-20-8-14)22-13-2-11(17)5-19-7-13/h1-9H |
| InChIKey | AKVWFAOVLOFEGK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |