C8H6ClN3OS — CID 102769518
2-[(5-chloro-3-pyridinyl)oxy]-1,3-thiazol-5-amine (PubChem CID 102769518) has the molecular formula C8H6ClN3OS and a molecular weight of 227.68 g/mol. Its IUPAC name is 2-[(5-chloro-3-pyridinyl)oxy]-1,3-thiazol-5-amine.
| Compound Name | 2-[(5-chloro-3-pyridinyl)oxy]-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 102769518 |
| Molecular Formula | C8H6ClN3OS |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 2-[(5-chloro-3-pyridinyl)oxy]-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(Oc2cncc(Cl)c2)s1 |
| InChI | InChI=1S/C8H6ClN3OS/c9-5-1-6(3-11-2-5)13-8-12-4-7(10)14-8/h1-4H,10H2 |
| InChIKey | BYSBNNOJVFDTRD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |