About CID 66825367
CID 66825367 (PubChem CID 66825367) has the molecular formula C10H6BCl2N2O2
and a molecular weight of 267.89 g/mol.
Molecular Properties
| Compound Name | CID 66825367 |
| PubChem CID | 66825367 |
| Molecular Formula | C10H6BCl2N2O2 |
| Molecular Weight | 267.89 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | — |
| SMILES | Clc1cncc(O[B]Oc2cncc(Cl)c2)c1 |
| InChI | InChI=1S/C10H6BCl2N2O2/c12-7-1-9(5-14-3-7)16-11-17-10-2-8(13)4-15-6-10/h1-6H |
| InChIKey | RQKOJJZYYOEAPB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.89 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66825367 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66825367?
The IUPAC name of CID 66825367 (CID 66825367) is not available.
What is the SMILES notation for CID 66825367?
The canonical SMILES for CID 66825367 is Clc1cncc(O[B]Oc2cncc(Cl)c2)c1.
What is the InChIKey of CID 66825367?
The InChIKey is RQKOJJZYYOEAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BCl2N2O2/c12-7-1-9(5-14-3-7)16-11-17-10-2-8(13)4-15-6-10/h1-6H.
What are the key properties of CID 66825367?
CID 66825367 has a molecular weight of 267.89 g/mol, XLogP of 2.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66825367 is sourced from PubChem (CID 66825367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).