About 3,5-dichloropyridine;ethane
3,5-dichloropyridine;ethane (PubChem CID 142010125) has the molecular formula C7H9Cl2N
and a molecular weight of 178.06 g/mol. Its IUPAC name is 3,5-dichloropyridine;ethane.
Molecular Properties
| Compound Name | 3,5-dichloropyridine;ethane |
| PubChem CID | 142010125 |
| Molecular Formula | C7H9Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 3,5-dichloropyridine;ethane |
| SMILES | CC.Clc1cncc(Cl)c1 |
| InChI | InChI=1S/C5H3Cl2N.C2H6/c6-4-1-5(7)3-8-2-4;1-2/h1-3H;1-2H3 |
| InChIKey | ZOKORUSWACQRMD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dichloropyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloropyridine;ethane?
The IUPAC name of 3,5-dichloropyridine;ethane (CID 142010125) is 3,5-dichloropyridine;ethane.
What is the SMILES notation for 3,5-dichloropyridine;ethane?
The canonical SMILES for 3,5-dichloropyridine;ethane is CC.Clc1cncc(Cl)c1.
What is the InChIKey of 3,5-dichloropyridine;ethane?
The InChIKey is ZOKORUSWACQRMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2N.C2H6/c6-4-1-5(7)3-8-2-4;1-2/h1-3H;1-2H3.
What are the key properties of 3,5-dichloropyridine;ethane?
3,5-dichloropyridine;ethane has a molecular weight of 178.06 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloropyridine;ethane is sourced from PubChem (CID 142010125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).